![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| spreadsheet.doc | 27-Jun-2012 14:36 | 47K | |
| conclusion.doc | 27-Jun-2012 14:36 | 21K | |
| energy.doc | 27-Jun-2012 14:36 | 49K | |
| hooke2010.docx | 27-Jun-2012 14:36 | 14K | |
| INS spreadsheet2011A.docx | 27-Jun-2012 14:36 | 19K | |
| hooke.doc | 27-Jun-2012 14:36 | 45K | |
| resistance.doc | 27-Jun-2012 14:36 | 44K | |
| DS spreadsheet2011A.docx | 27-Jun-2012 14:36 | 13K | |
| specificheat.doc | 27-Jun-2012 14:36 | 39K | |
| lens.doc | 27-Jun-2012 14:36 | 64K | |
| Vibratingstring2010.docx | 27-Jun-2012 14:36 | 34K | |
| Resistance and Ohms Law.docx | 27-Jun-2012 14:36 | 21K | |
| motion.doc | 27-Jun-2012 14:36 | 58K | |
| waves.doc | 27-Jun-2012 14:36 | 43K | |
| schedule.html | 27-Jun-2012 14:36 | 3.4K | |
| sgle.doc | 27-Jun-2012 14:36 | 24K | |
| Torque2010.docx | 27-Jun-2012 14:36 | 32K | |
| energy2010.docx | 27-Jun-2012 14:36 | 19K | |
| Gaslaws2010.docx | 27-Jun-2012 14:36 | 14K | |
| phys101sch.html | 27-Jun-2012 14:36 | 4.1K | |
| phys102sch.html | 27-Jun-2012 14:36 | 4.2K | |
| units.doc | 27-Jun-2012 14:36 | 52K | |
| sgle Summer 09.doc | 27-Jun-2012 14:36 | 22K | |
| Discover Pi Pasco Manual.pdf | 27-Jun-2012 14:36 | 238K | |
| densityA2011.docx | 27-Jun-2012 14:36 | 23K | |
| spreadsheet2011A.docx | 27-Jun-2012 14:36 | 16K | |
| specificheat2010.docx | 27-Jun-2012 14:36 | 13K | |
| pendulum.doc | 27-Jun-2012 14:36 | 64K | |
| wp.doc | 27-Jun-2012 14:36 | 38K | |
| Motion.docx | 27-Jun-2012 14:36 | 57K | |
| rev phys102home.html | 27-Jun-2012 14:36 | 20K | |
| ohmslaw.doc | 27-Jun-2012 14:36 | 5.4M | |
| basics.doc | 27-Jun-2012 14:36 | 19K | |
| labsch.html | 27-Jun-2012 14:36 | 2.3K | |
| spreadsheet2010A.doc | 27-Jun-2012 14:36 | 45K | |
| Induction2010.docx | 27-Jun-2012 14:36 | 15K | |
| lens.docx | 27-Jun-2012 14:36 | 23K | |
| Pendulum with motion sensor.doc | 27-Jun-2012 14:36 | 22K | |
| phys101home.html | 27-Jun-2012 14:36 | 5.2K | |
| Kinematic Equations.docx | 27-Jun-2012 14:36 | 52K | |
| phys102home with formal lab rep.html | 27-Jun-2012 14:36 | 21K | |
| spreadsheet2010A.docx | 27-Jun-2012 14:36 | 20K | |
| wp 2010.docx | 27-Jun-2012 14:36 | 17K | |
| energy.docx | 27-Jun-2012 14:36 | 18K | |
| acceleration.doc | 27-Jun-2012 14:36 | 44K | |
| density.doc | 27-Jun-2012 14:36 | 51K | |
| Reaction Time.jpg | 27-Jun-2012 14:36 | 1.0M | |
| units2010A.doc | 27-Jun-2012 14:36 | 45K | |
| wp and pendulum.docx | 27-Jun-2012 14:36 | 29K | |
| scheduleUC.html | 27-Jun-2012 14:36 | 3.9K | |
| densityA2012.docx | 15-May-2013 12:18 | 23K | |
| pendulum.docx | 15-May-2013 12:18 | 24K | |
| Spreadsheet and Graphing 2013.docx | 15-May-2013 12:18 | 23K | |
| L4 Second law of Newton.docx | 15-May-2013 15:58 | 82K | |
| Work & Power.docx | 15-May-2013 15:58 | 26K | |
| Energy 2013.docx | 17-May-2013 15:10 | 21K | |
| L7 Hooke's Law.docx | 17-May-2013 15:11 | 17K | |
| L8 Centripetal force.docx | 17-May-2013 15:11 | 237K | |
| L9 TORQUE.docx | 22-May-2013 10:24 | 42K | |
| Specificheat2013.docx | 23-May-2013 08:30 | 22K | |
| TORQUE2013.docx | 23-May-2013 08:32 | 54K | |
| Centrepetal Force.xlsx | 24-May-2013 10:04 | 10K | |
| Ohms Law 2013.docx | 27-May-2013 11:29 | 4.2M | |
| Magnetic Field Mapping and Induction 2013.docx | 28-May-2013 08:26 | 637K | |
| A2013labsch.html | 28-May-2013 15:23 | 2.7K | |
| Vibratingstring 2013.docx | 28-May-2013 15:23 | 116K | |
| Centripetal force 2013.docx | 21-Jun-2013 10:36 | 256K | |
| A2014labsch.html | 29-May-2014 11:55 | 2.6K | |
| phys102home.html | 16-Aug-2022 12:36 | 17K | |