![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[DIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | themedata.thmx | 23-Feb-2016 09:29 | 3.0K | |
![[IMG]](/icons/image2.gif) | image004.gif | 23-Feb-2016 09:29 | 840 | |
| image001.gif | 23-Feb-2016 09:29 | 3.6K | |
![[TXT]](/icons/text.gif) | header.html | 23-Feb-2016 09:29 | 4.4K | |
| filelist.xml | 23-Feb-2016 09:29 | 277 | |
| colorschememapping.xml | 23-Feb-2016 09:29 | 314 | |
| chem304home.html | 24-Jan-2018 15:13 | 90K | |
| WS_FTP.LOG | 23-Feb-2016 09:29 | 20K | |
| TLC of Analgesics(WU) - Rev 10-08.doc | 23-Feb-2016 09:29 | 38K | |
| Report Guidelines Rev 9-2014.doc | 23-Feb-2016 09:29 | 52K | |
| Notebook Guidelines Rev 9-2014.doc | 23-Feb-2016 09:29 | 31K | |
| NODOC.htm | 23-Feb-2016 09:29 | 3.5K | |
| NMR Instructions Rev 7-2006 JMH.doc | 23-Feb-2016 09:29 | 129K | |
| Instructions for Mel-Temp.doc | 23-Feb-2016 09:29 | 39K | |
| Instructions for Electrothermal 9100.doc | 23-Feb-2016 09:29 | 138K | |
| IR Instructions Rev 6-2008 JMH.doc | 23-Feb-2016 09:29 | 541K | |
![[DIR]](/icons/folder.gif) | Guides and Instructions/ | 14-Jan-2019 09:43 | - | |
| GrignardWU - Rev 3-11.doc | 23-Feb-2016 09:29 | 757K | |
![[ ]](/icons/layout.gif) | GC MS Procedure for Caffeine Rev 1-2012.pdf | 23-Feb-2016 09:29 | 518K | |
| GC Instructions.doc | 23-Feb-2016 09:29 | 27K | |
| Fischer Esterification (MW)WU Rev 3-11 (MARS).doc | 23-Feb-2016 09:29 | 37K | |
| Fat Extraction.docx | 23-Feb-2016 09:29 | 93K | |
| Experiments/ | 31-Jan-2020 15:33 | - | |
| Example Technique Lab Report Rev 9-2014.docx | 23-Feb-2016 09:29 | 85K | |
| Example Technique Lab Report Rev 1-2016.docx | 23-Feb-2016 09:29 | 89K | |
| Example Reaction Lab Report Rev 9-2014.docx | 23-Feb-2016 09:29 | 83K | |
| Example Reaction Lab Report Rev 1-2016.docx | 23-Feb-2016 09:29 | 83K | |
| Cover Sheet-Prelab.doc | 23-Feb-2016 09:29 | 55K | |
| ColumnChromatographyWU Rev 11-08.doc | 23-Feb-2016 09:29 | 640K | |
| CHEM 304 Syllabus(S23).docx | 09-Jan-2023 09:32 | 28K | |
| CHEM 304 Syllabus(S22).docx | 12-Jan-2022 09:51 | 26K | |
| CHEM 304 Syllabus(S20).docx | 08-Jan-2020 13:29 | 23K | |
| CHEM 304 Syllabus(S19).docx | 23-Jan-2019 11:02 | 29K | |
| CHEM 304 Syllabus(S18).docx | 08-Jan-2018 11:18 | 26K | |
| CHEM 304 Syllabus(S17).docx | 09-Jan-2017 10:11 | 25K | |
| CHEM 304 Syllabus(S16).docx | 23-Feb-2016 09:29 | 25K | |
| CHEM 304 Syllabus(F22).docx | 22-Aug-2022 10:18 | 26K | |
| CHEM 304 Syllabus(F21).pdf | 23-Aug-2021 12:59 | 136K | |
| CHEM 304 Syllabus(F20).pdf | 26-Aug-2020 13:48 | 134K | |
| CHEM 304 Syllabus(F19).pdf | 19-Aug-2019 10:06 | 34K | |
| CHEM 304 Schedule of Experiments(S23).docx | 09-Jan-2023 09:32 | 19K | |
| CHEM 304 Schedule of Experiments(S22).docx | 12-Jan-2022 09:51 | 22K | |
| CHEM 304 Schedule of Experiments(S20).docx | 08-Jan-2020 13:29 | 17K | |
| CHEM 304 Schedule of Experiments(S19).docx | 03-Jan-2019 13:46 | 16K | |
| CHEM 304 Schedule of Experiments(S18)Rev2.docx | 19-Jan-2018 11:50 | 18K | |
| CHEM 304 Schedule of Experiments(S18).docx | 10-Jan-2018 09:53 | 18K | |
| CHEM 304 Schedule of Experiments(S17).docx | 03-Jan-2017 15:05 | 18K | |
| CHEM 304 Schedule of Experiments(S16).docx | 23-Feb-2016 09:29 | 22K | |
| CHEM 304 Schedule of Experiments(F22).docx | 22-Aug-2022 10:18 | 19K | |
| CHEM 304 Schedule of Experiments(F20).docx | 26-Aug-2020 13:49 | 19K | |
| CHEM 304 Schedule of Experiments(F19).docx | 19-Aug-2019 10:06 | 20K | |
| CHEM 304 Archive/ | 23-Feb-2016 09:29 | - | |
| AldolWU Rev 2-14.docx | 23-Feb-2016 09:29 | 49K | |
|
|---|
